C29H42ClFO2 — CID 139866699
(4-chloro-3-fluorophenyl) 4-(6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate (PubChem CID 139866699) has the molecular formula C29H42ClFO2 and a molecular weight of 477.10 g/mol. Its IUPAC name is (4-chloro-3-fluorophenyl) 4-(6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate.
| Compound Name | (4-chloro-3-fluorophenyl) 4-(6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139866699 |
| Molecular Formula | C29H42ClFO2 |
| Molecular Weight | 477.10 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | (4-chloro-3-fluorophenyl) 4-(6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
| SMILES | CCCCCCC1CCC2CC(C3CCC(C(=O)Oc4ccc(Cl)c(F)c4)CC3)CCC2C1 |
| InChI | InChI=1S/C29H42ClFO2/c1-2-3-4-5-6-20-7-8-25-18-24(14-13-23(25)17-20)21-9-11-22(12-10-21)29(32)33-26-15-16-27(30)28(31)19-26/h15-16,19-25H,2-14,17-18H2,1H3 |
| InChIKey | NZUTYAMCZFAHEQ-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.10 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|