C28H42O3 — CID 139866991
(4-methoxyphenyl) 4-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate (PubChem CID 139866991) has the molecular formula C28H42O3 and a molecular weight of 426.64 g/mol. Its IUPAC name is (4-methoxyphenyl) 4-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate.
| Compound Name | (4-methoxyphenyl) 4-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139866991 |
| Molecular Formula | C28H42O3 |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.31 |
| IUPAC Name | (4-methoxyphenyl) 4-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC2CC(C3CCC(C(=O)Oc4ccc(OC)cc4)CC3)CCC2C1 |
| InChI | InChI=1S/C28H42O3/c1-3-4-5-20-6-7-25-19-24(13-12-23(25)18-20)21-8-10-22(11-9-21)28(29)31-27-16-14-26(30-2)15-17-27/h14-17,20-25H,3-13,18-19H2,1-2H3 |
| InChIKey | ILZIQKLVWYAWPD-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|