C30H44O3 — CID 139869594
(4-prop-2-enoxyphenyl) 4-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate (PubChem CID 139869594) has the molecular formula C30H44O3 and a molecular weight of 452.68 g/mol. Its IUPAC name is (4-prop-2-enoxyphenyl) 4-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate.
| Compound Name | (4-prop-2-enoxyphenyl) 4-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139869594 |
| Molecular Formula | C30H44O3 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | (4-prop-2-enoxyphenyl) 4-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
| SMILES | C=CCOc1ccc(OC(=O)C2CCC(C3CCC4CC(CCCC)CCC4C3)CC2)cc1 |
| InChI | InChI=1S/C30H44O3/c1-3-5-6-22-7-8-27-21-26(14-13-25(27)20-22)23-9-11-24(12-10-23)30(31)33-29-17-15-28(16-18-29)32-19-4-2/h4,15-18,22-27H,2-3,5-14,19-21H2,1H3 |
| InChIKey | UJBAPCNLCSIOGO-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|