C18H24O3 — CID 15218955
(4-prop-2-enoxyphenyl) 4-ethylcyclohexane-1-carboxylate (PubChem CID 15218955) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is (4-prop-2-enoxyphenyl) 4-ethylcyclohexane-1-carboxylate.
| Compound Name | (4-prop-2-enoxyphenyl) 4-ethylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 15218955 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (4-prop-2-enoxyphenyl) 4-ethylcyclohexane-1-carboxylate |
| SMILES | C=CCOc1ccc(OC(=O)C2CCC(CC)CC2)cc1 |
| InChI | InChI=1S/C18H24O3/c1-3-13-20-16-9-11-17(12-10-16)21-18(19)15-7-5-14(4-2)6-8-15/h3,9-12,14-15H,1,4-8,13H2,2H3 |
| InChIKey | ZURMZOJOUIMOTN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|