C23H36O2 — CID 90929650
ethane;phenyl 4-(4-ethylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 90929650) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is ethane;phenyl 4-(4-ethylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | ethane;phenyl 4-(4-ethylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 90929650 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | ethane;phenyl 4-(4-ethylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CC.CCC1CCC(C2CCC(C(=O)Oc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C21H30O2.C2H6/c1-2-16-8-10-17(11-9-16)18-12-14-19(15-13-18)21(22)23-20-6-4-3-5-7-20;1-2/h3-7,16-19H,2,8-15H2,1H3;1-2H3 |
| InChIKey | OEDIJLUENNFNRD-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|