C15H20O2 — CID 53401345
phenyl 4-ethylcyclohexane-1-carboxylate (PubChem CID 53401345) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is phenyl 4-ethylcyclohexane-1-carboxylate.
| Compound Name | phenyl 4-ethylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 53401345 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | phenyl 4-ethylcyclohexane-1-carboxylate |
| SMILES | CCC1CCC(C(=O)Oc2ccccc2)CC1 |
| InChI | InChI=1S/C15H20O2/c1-2-12-8-10-13(11-9-12)15(16)17-14-6-4-3-5-7-14/h3-7,12-13H,2,8-11H2,1H3 |
| InChIKey | LBJOYZZZPHPIGP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|