About 1-azabicyclo[2.2.2]octane;phenyl cyclopropanecarboxylate
1-azabicyclo[2.2.2]octane;phenyl cyclopropanecarboxylate (PubChem CID 174407037) has the molecular formula C17H23NO2
and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octane;phenyl cyclopropanecarboxylate.
Molecular Properties
| Compound Name | 1-azabicyclo[2.2.2]octane;phenyl cyclopropanecarboxylate |
| PubChem CID | 174407037 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 1-azabicyclo[2.2.2]octane;phenyl cyclopropanecarboxylate |
| SMILES | C1CN2CCC1CC2.O=C(Oc1ccccc1)C1CC1 |
| InChI | InChI=1S/C10H10O2.C7H13N/c11-10(8-6-7-8)12-9-4-2-1-3-5-9;1-4-8-5-2-7(1)3-6-8/h1-5,8H,6-7H2;7H,1-6H2 |
| InChIKey | RRRQFKCMVVKEJZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1-azabicyclo[2.2.2]octane;phenyl cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[2.2.2]octane;phenyl cyclopropanecarboxylate?
The IUPAC name of 1-azabicyclo[2.2.2]octane;phenyl cyclopropanecarboxylate (CID 174407037) is 1-azabicyclo[2.2.2]octane;phenyl cyclopropanecarboxylate.
What is the SMILES notation for 1-azabicyclo[2.2.2]octane;phenyl cyclopropanecarboxylate?
The canonical SMILES for 1-azabicyclo[2.2.2]octane;phenyl cyclopropanecarboxylate is C1CN2CCC1CC2.O=C(Oc1ccccc1)C1CC1.
What is the InChIKey of 1-azabicyclo[2.2.2]octane;phenyl cyclopropanecarboxylate?
The InChIKey is RRRQFKCMVVKEJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2.C7H13N/c11-10(8-6-7-8)12-9-4-2-1-3-5-9;1-4-8-5-2-7(1)3-6-8/h1-5,8H,6-7H2;7H,1-6H2.
What are the key properties of 1-azabicyclo[2.2.2]octane;phenyl cyclopropanecarboxylate?
1-azabicyclo[2.2.2]octane;phenyl cyclopropanecarboxylate has a molecular weight of 273.38 g/mol, XLogP of 3.10, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[2.2.2]octane;phenyl cyclopropanecarboxylate is sourced from PubChem (CID 174407037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).