C15H18O4 — CID 164675050
cis-(1R,2S)-2-methyl-4-phenoxycarbonylcyclohexane-1-carboxylic acid (PubChem CID 164675050) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is cis-(1R,2S)-2-methyl-4-phenoxycarbonylcyclohexane-1-carboxylic acid.
| Compound Name | cis-(1R,2S)-2-methyl-4-phenoxycarbonylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 164675050 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | cis-(1R,2S)-2-methyl-4-phenoxycarbonylcyclohexane-1-carboxylic acid |
| SMILES | C[C@H]1CC(C(=O)Oc2ccccc2)CC[C@H]1C(=O)O |
| InChI | InChI=1S/C15H18O4/c1-10-9-11(7-8-13(10)14(16)17)15(18)19-12-5-3-2-4-6-12/h2-6,10-11,13H,7-9H2,1H3,(H,16,17)/t10-,11?,13+/m0/s1 |
| InChIKey | FAZHRPJJTJTRLF-CCQDYZPNSA-N |
| XLogP | 2.73 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|