C24H36O4 — CID 90858255
ethane;[4-(4-methylcyclohexanecarbonyl)oxyphenyl] 4-methylcyclohexane-1-carboxylate (PubChem CID 90858255) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is ethane;[4-(4-methylcyclohexanecarbonyl)oxyphenyl] 4-methylcyclohexane-1-carboxylate.
| Compound Name | ethane;[4-(4-methylcyclohexanecarbonyl)oxyphenyl] 4-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 90858255 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | ethane;[4-(4-methylcyclohexanecarbonyl)oxyphenyl] 4-methylcyclohexane-1-carboxylate |
| SMILES | CC.CC1CCC(C(=O)Oc2ccc(OC(=O)C3CCC(C)CC3)cc2)CC1 |
| InChI | InChI=1S/C22H30O4.C2H6/c1-15-3-7-17(8-4-15)21(23)25-19-11-13-20(14-12-19)26-22(24)18-9-5-16(2)6-10-18;1-2/h11-18H,3-10H2,1-2H3;1-2H3 |
| InChIKey | PBONVOVGVSJNKZ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|