C15H22O2 — CID 160876480
(4-methylphenyl) 4-methylcyclohexane-1-carboxylate;molecular hydrogen (PubChem CID 160876480) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (4-methylphenyl) 4-methylcyclohexane-1-carboxylate;molecular hydrogen.
| Compound Name | (4-methylphenyl) 4-methylcyclohexane-1-carboxylate;molecular hydrogen |
|---|---|
| PubChem CID | 160876480 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (4-methylphenyl) 4-methylcyclohexane-1-carboxylate;molecular hydrogen |
| SMILES | Cc1ccc(OC(=O)C2CCC(C)CC2)cc1.[H][H] |
| InChI | InChI=1S/C15H20O2.H2/c1-11-3-7-13(8-4-11)15(16)17-14-9-5-12(2)6-10-14;/h5-6,9-11,13H,3-4,7-8H2,1-2H3;1H |
| InChIKey | SMLQRIRPHROWHI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|