C25H28O2 — CID 54498488
ethene;[4-[2-(4-methylphenyl)ethynyl]phenyl] 4-methylcyclohexane-1-carboxylate (PubChem CID 54498488) has the molecular formula C25H28O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is ethene;[4-[2-(4-methylphenyl)ethynyl]phenyl] 4-methylcyclohexane-1-carboxylate.
| Compound Name | ethene;[4-[2-(4-methylphenyl)ethynyl]phenyl] 4-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54498488 |
| Molecular Formula | C25H28O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | ethene;[4-[2-(4-methylphenyl)ethynyl]phenyl] 4-methylcyclohexane-1-carboxylate |
| SMILES | C=C.Cc1ccc(C#Cc2ccc(OC(=O)C3CCC(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C23H24O2.C2H4/c1-17-3-7-19(8-4-17)9-10-20-11-15-22(16-12-20)25-23(24)21-13-5-18(2)6-14-21;1-2/h3-4,7-8,11-12,15-16,18,21H,5-6,13-14H2,1-2H3;1-2H2 |
| InChIKey | YAUFPFAKJJEYOH-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|