C28H30O2 — CID 67827853
[4-[2-(4-pent-1-ynylphenyl)ethynyl]phenyl] 4-ethylcyclohexane-1-carboxylate (PubChem CID 67827853) has the molecular formula C28H30O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is [4-[2-(4-pent-1-ynylphenyl)ethynyl]phenyl] 4-ethylcyclohexane-1-carboxylate.
| Compound Name | [4-[2-(4-pent-1-ynylphenyl)ethynyl]phenyl] 4-ethylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 67827853 |
| Molecular Formula | C28H30O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | [4-[2-(4-pent-1-ynylphenyl)ethynyl]phenyl] 4-ethylcyclohexane-1-carboxylate |
| SMILES | CCCC#Cc1ccc(C#Cc2ccc(OC(=O)C3CCC(CC)CC3)cc2)cc1 |
| InChI | InChI=1S/C28H30O2/c1-3-5-6-7-23-8-10-24(11-9-23)12-13-25-16-20-27(21-17-25)30-28(29)26-18-14-22(4-2)15-19-26/h8-11,16-17,20-22,26H,3-5,14-15,18-19H2,1-2H3 |
| InChIKey | UEKDMJJFCAETHL-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|