C26H32O2 — CID 54254635
[4-(4-methylphenyl)phenyl] 4-cyclohexylcyclohexane-1-carboxylate (PubChem CID 54254635) has the molecular formula C26H32O2 and a molecular weight of 376.54 g/mol. Its IUPAC name is [4-(4-methylphenyl)phenyl] 4-cyclohexylcyclohexane-1-carboxylate.
| Compound Name | [4-(4-methylphenyl)phenyl] 4-cyclohexylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54254635 |
| Molecular Formula | C26H32O2 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | [4-(4-methylphenyl)phenyl] 4-cyclohexylcyclohexane-1-carboxylate |
| SMILES | Cc1ccc(-c2ccc(OC(=O)C3CCC(C4CCCCC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C26H32O2/c1-19-7-9-21(10-8-19)23-15-17-25(18-16-23)28-26(27)24-13-11-22(12-14-24)20-5-3-2-4-6-20/h7-10,15-18,20,22,24H,2-6,11-14H2,1H3 |
| InChIKey | BXFGNAWOJQAFGG-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|