C26H24O4 — CID 20724345
(4-phenylphenyl) 4-(cyclohexanecarbonyloxy)benzoate (PubChem CID 20724345) has the molecular formula C26H24O4 and a molecular weight of 400.47 g/mol. Its IUPAC name is (4-phenylphenyl) 4-(cyclohexanecarbonyloxy)benzoate.
| Compound Name | (4-phenylphenyl) 4-(cyclohexanecarbonyloxy)benzoate |
|---|---|
| PubChem CID | 20724345 |
| Molecular Formula | C26H24O4 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | (4-phenylphenyl) 4-(cyclohexanecarbonyloxy)benzoate |
| SMILES | O=C(Oc1ccc(-c2ccccc2)cc1)c1ccc(OC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C26H24O4/c27-25(21-9-5-2-6-10-21)29-24-17-13-22(14-18-24)26(28)30-23-15-11-20(12-16-23)19-7-3-1-4-8-19/h1,3-4,7-8,11-18,21H,2,5-6,9-10H2 |
| InChIKey | QCEZWZMPAYRQCR-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|