C19H19NO3 — CID 26191011
(4-benzamidophenyl) cyclopentanecarboxylate (PubChem CID 26191011) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is (4-benzamidophenyl) cyclopentanecarboxylate.
| Compound Name | (4-benzamidophenyl) cyclopentanecarboxylate |
|---|---|
| PubChem CID | 26191011 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (4-benzamidophenyl) cyclopentanecarboxylate |
| SMILES | O=C(Nc1ccc(OC(=O)C2CCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H19NO3/c21-18(14-6-2-1-3-7-14)20-16-10-12-17(13-11-16)23-19(22)15-8-4-5-9-15/h1-3,6-7,10-13,15H,4-5,8-9H2,(H,20,21) |
| InChIKey | BBXLMPGHOZVDLF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|