C22H17NO3S — CID 55487595
(4-benzamidophenyl) 2,3-dihydro-1-benzothiophene-2-carboxylate (PubChem CID 55487595) has the molecular formula C22H17NO3S and a molecular weight of 375.45 g/mol. Its IUPAC name is (4-benzamidophenyl) 2,3-dihydro-1-benzothiophene-2-carboxylate.
| Compound Name | (4-benzamidophenyl) 2,3-dihydro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 55487595 |
| Molecular Formula | C22H17NO3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | (4-benzamidophenyl) 2,3-dihydro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(Nc1ccc(OC(=O)C2Cc3ccccc3S2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H17NO3S/c24-21(15-6-2-1-3-7-15)23-17-10-12-18(13-11-17)26-22(25)20-14-16-8-4-5-9-19(16)27-20/h1-13,20H,14H2,(H,23,24) |
| InChIKey | NYYOUVURBQEYCC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|