C16H14N2O2S — CID 51309523
N'-benzoyl-2,3-dihydro-1-benzothiophene-2-carbohydrazide (PubChem CID 51309523) has the molecular formula C16H14N2O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is N'-benzoyl-2,3-dihydro-1-benzothiophene-2-carbohydrazide.
| Compound Name | N'-benzoyl-2,3-dihydro-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 51309523 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | N'-benzoyl-2,3-dihydro-1-benzothiophene-2-carbohydrazide |
| SMILES | O=C(NNC(=O)C1Cc2ccccc2S1)c1ccccc1 |
| InChI | InChI=1S/C16H14N2O2S/c19-15(11-6-2-1-3-7-11)17-18-16(20)14-10-12-8-4-5-9-13(12)21-14/h1-9,14H,10H2,(H,17,19)(H,18,20) |
| InChIKey | KTWRDKFZWJEFNF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|