C21H15ClN2O4S — CID 60526495
(4-benzamidophenyl) 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate (PubChem CID 60526495) has the molecular formula C21H15ClN2O4S and a molecular weight of 426.88 g/mol. Its IUPAC name is (4-benzamidophenyl) 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate.
| Compound Name | (4-benzamidophenyl) 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 60526495 |
| Molecular Formula | C21H15ClN2O4S |
| Molecular Weight | 426.88 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | (4-benzamidophenyl) 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate |
| SMILES | O=C(Nc1ccc(OC(=O)C2CC(c3ccc(Cl)s3)=NO2)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H15ClN2O4S/c22-19-11-10-18(29-19)16-12-17(28-24-16)21(26)27-15-8-6-14(7-9-15)23-20(25)13-4-2-1-3-5-13/h1-11,17H,12H2,(H,23,25) |
| InChIKey | DSMMSWMEZZMWSK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.88 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|