C14H16ClN3O3S — CID 71939531
3-(5-chlorothiophen-2-yl)-N-[2-(cyclopropanecarbonylamino)ethyl]-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 71939531) has the molecular formula C14H16ClN3O3S and a molecular weight of 341.82 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)-N-[2-(cyclopropanecarbonylamino)ethyl]-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | 3-(5-chlorothiophen-2-yl)-N-[2-(cyclopropanecarbonylamino)ethyl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 71939531 |
| Molecular Formula | C14H16ClN3O3S |
| Molecular Weight | 341.82 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)-N-[2-(cyclopropanecarbonylamino)ethyl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NCCNC(=O)C1CC(c2ccc(Cl)s2)=NO1)C1CC1 |
| InChI | InChI=1S/C14H16ClN3O3S/c15-12-4-3-11(22-12)9-7-10(21-18-9)14(20)17-6-5-16-13(19)8-1-2-8/h3-4,8,10H,1-2,5-7H2,(H,16,19)(H,17,20) |
| InChIKey | PHADWBBPUDHILA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.82 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|