C11H9ClN2O2S — CID 47301490
3-(5-chlorothiophen-2-yl)-N-prop-2-ynyl-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 47301490) has the molecular formula C11H9ClN2O2S and a molecular weight of 268.72 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)-N-prop-2-ynyl-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | 3-(5-chlorothiophen-2-yl)-N-prop-2-ynyl-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 47301490 |
| Molecular Formula | C11H9ClN2O2S |
| Molecular Weight | 268.72 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)-N-prop-2-ynyl-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | C#CCNC(=O)C1CC(c2ccc(Cl)s2)=NO1 |
| InChI | InChI=1S/C11H9ClN2O2S/c1-2-5-13-11(15)8-6-7(14-16-8)9-3-4-10(12)17-9/h1,3-4,8H,5-6H2,(H,13,15) |
| InChIKey | FXDBKZWELYCMNO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.72 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|