C16H13ClN2O4S — CID 60524248
(4-acetamidophenyl) 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate (PubChem CID 60524248) has the molecular formula C16H13ClN2O4S and a molecular weight of 364.81 g/mol. Its IUPAC name is (4-acetamidophenyl) 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate.
| Compound Name | (4-acetamidophenyl) 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 60524248 |
| Molecular Formula | C16H13ClN2O4S |
| Molecular Weight | 364.81 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | (4-acetamidophenyl) 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate |
| SMILES | CC(=O)Nc1ccc(OC(=O)C2CC(c3ccc(Cl)s3)=NO2)cc1 |
| InChI | InChI=1S/C16H13ClN2O4S/c1-9(20)18-10-2-4-11(5-3-10)22-16(21)13-8-12(19-23-13)14-6-7-15(17)24-14/h2-7,13H,8H2,1H3,(H,18,20) |
| InChIKey | YVMVQQKQZPJPFS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.81 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|