C15H9ClF3NO3S — CID 60526672
[2-(trifluoromethyl)phenyl] 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate (PubChem CID 60526672) has the molecular formula C15H9ClF3NO3S and a molecular weight of 375.76 g/mol. Its IUPAC name is [2-(trifluoromethyl)phenyl] 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate.
| Compound Name | [2-(trifluoromethyl)phenyl] 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 60526672 |
| Molecular Formula | C15H9ClF3NO3S |
| Molecular Weight | 375.76 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | [2-(trifluoromethyl)phenyl] 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate |
| SMILES | O=C(Oc1ccccc1C(F)(F)F)C1CC(c2ccc(Cl)s2)=NO1 |
| InChI | InChI=1S/C15H9ClF3NO3S/c16-13-6-5-12(24-13)9-7-11(23-20-9)14(21)22-10-4-2-1-3-8(10)15(17,18)19/h1-6,11H,7H2 |
| InChIKey | USWPNDSKLPCTOL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.76 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|