C15H16ClNO3S — CID 60527208
cyclohex-3-en-1-ylmethyl 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate (PubChem CID 60527208) has the molecular formula C15H16ClNO3S and a molecular weight of 325.82 g/mol. Its IUPAC name is cyclohex-3-en-1-ylmethyl 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate.
| Compound Name | cyclohex-3-en-1-ylmethyl 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 60527208 |
| Molecular Formula | C15H16ClNO3S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | cyclohex-3-en-1-ylmethyl 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate |
| SMILES | O=C(OCC1CC=CCC1)C1CC(c2ccc(Cl)s2)=NO1 |
| InChI | InChI=1S/C15H16ClNO3S/c16-14-7-6-13(21-14)11-8-12(20-17-11)15(18)19-9-10-4-2-1-3-5-10/h1-2,6-7,10,12H,3-5,8-9H2 |
| InChIKey | JYHJJWOGRNXTLF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|