C18H18ClN3O3S2 — CID 95653680
(5S)-N-(3-carbamoyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 95653680) has the molecular formula C18H18ClN3O3S2 and a molecular weight of 423.95 g/mol. Its IUPAC name is (5S)-N-(3-carbamoyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | (5S)-N-(3-carbamoyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 95653680 |
| Molecular Formula | C18H18ClN3O3S2 |
| Molecular Weight | 423.95 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | (5S)-N-(3-carbamoyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)[C@@H]2CC(c3ccc(Cl)s3)=NO2)sc2c1CCCCC2 |
| InChI | InChI=1S/C18H18ClN3O3S2/c19-14-7-6-13(26-14)10-8-11(25-22-10)17(24)21-18-15(16(20)23)9-4-2-1-3-5-12(9)27-18/h6-7,11H,1-5,8H2,(H2,20,23)(H,21,24)/t11-/m0/s1 |
| InChIKey | DDRDPDIMTXZZDR-NSHDSACASA-N |
| XLogP | 3.96 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.95 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |