C21H16O2S — CID 97082979
(2-phenylphenyl) (2R)-2,3-dihydro-1-benzothiophene-2-carboxylate (PubChem CID 97082979) has the molecular formula C21H16O2S and a molecular weight of 332.42 g/mol. Its IUPAC name is (2-phenylphenyl) (2R)-2,3-dihydro-1-benzothiophene-2-carboxylate.
| Compound Name | (2-phenylphenyl) (2R)-2,3-dihydro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 97082979 |
| Molecular Formula | C21H16O2S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | (2-phenylphenyl) (2R)-2,3-dihydro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(Oc1ccccc1-c1ccccc1)[C@H]1Cc2ccccc2S1 |
| InChI | InChI=1S/C21H16O2S/c22-21(20-14-16-10-4-7-13-19(16)24-20)23-18-12-6-5-11-17(18)15-8-2-1-3-9-15/h1-13,20H,14H2/t20-/m1/s1 |
| InChIKey | QJNZUZUMMPKFBL-HXUWFJFHSA-N |
| XLogP | 4.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|