C9H7O2S- — CID 74756271
2,3-dihydro-1-benzothiophene-2-carboxylate (PubChem CID 74756271) has the molecular formula C9H7O2S- and a molecular weight of 179.22 g/mol. Its IUPAC name is 2,3-dihydro-1-benzothiophene-2-carboxylate.
| Compound Name | 2,3-dihydro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 74756271 |
| Molecular Formula | C9H7O2S- |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.02 |
| IUPAC Name | 2,3-dihydro-1-benzothiophene-2-carboxylate |
| SMILES | O=C([O-])C1Cc2ccccc2S1 |
| InChI | InChI=1S/C9H8O2S/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-4,8H,5H2,(H,10,11)/p-1 |
| InChIKey | GSCAVDGYZRSZJS-UHFFFAOYSA-M |
| XLogP | 0.45 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |