C15H13NO2S — CID 51489865
(2R)-N-(2-hydroxyphenyl)-2,3-dihydro-1-benzothiophene-2-carboxamide (PubChem CID 51489865) has the molecular formula C15H13NO2S and a molecular weight of 271.34 g/mol. Its IUPAC name is (2R)-N-(2-hydroxyphenyl)-2,3-dihydro-1-benzothiophene-2-carboxamide.
| Compound Name | (2R)-N-(2-hydroxyphenyl)-2,3-dihydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 51489865 |
| Molecular Formula | C15H13NO2S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | (2R)-N-(2-hydroxyphenyl)-2,3-dihydro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1O)[C@H]1Cc2ccccc2S1 |
| InChI | InChI=1S/C15H13NO2S/c17-12-7-3-2-6-11(12)16-15(18)14-9-10-5-1-4-8-13(10)19-14/h1-8,14,17H,9H2,(H,16,18)/t14-/m1/s1 |
| InChIKey | CJVDATYUKXFMLM-CQSZACIVSA-N |
| XLogP | 3.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|