C22H20N2O5S2 — CID 24596987
N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-2,3-dihydro-1-benzothiophene-2-carboxamide (PubChem CID 24596987) has the molecular formula C22H20N2O5S2 and a molecular weight of 456.55 g/mol. Its IUPAC name is N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-2,3-dihydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-2,3-dihydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 24596987 |
| Molecular Formula | C22H20N2O5S2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-2,3-dihydro-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(O)c(NC(=O)C2Cc3ccccc3S2)c1 |
| InChI | InChI=1S/C22H20N2O5S2/c1-29-19-8-4-3-7-16(19)24-31(27,28)15-10-11-18(25)17(13-15)23-22(26)21-12-14-6-2-5-9-20(14)30-21/h2-11,13,21,24-25H,12H2,1H3,(H,23,26) |
| InChIKey | PUVSFWLOLUWVGF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|