C19H18N2O6S — CID 24588243
N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-2-methylfuran-3-carboxamide (PubChem CID 24588243) has the molecular formula C19H18N2O6S and a molecular weight of 402.43 g/mol. Its IUPAC name is N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-2-methylfuran-3-carboxamide.
| Compound Name | N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 24588243 |
| Molecular Formula | C19H18N2O6S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-2-methylfuran-3-carboxamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(O)c(NC(=O)c2ccoc2C)c1 |
| InChI | InChI=1S/C19H18N2O6S/c1-12-14(9-10-27-12)19(23)20-16-11-13(7-8-17(16)22)28(24,25)21-15-5-3-4-6-18(15)26-2/h3-11,21-22H,1-2H3,(H,20,23) |
| InChIKey | YQVKUQVLHZOSQD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|