C21H18N4O7S — CID 35862149
N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-6-methyl-4-oxo-3H-furo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 35862149) has the molecular formula C21H18N4O7S and a molecular weight of 470.46 g/mol. Its IUPAC name is N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-6-methyl-4-oxo-3H-furo[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-6-methyl-4-oxo-3H-furo[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 35862149 |
| Molecular Formula | C21H18N4O7S |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-6-methyl-4-oxo-3H-furo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(O)c(NC(=O)c2c(C)oc3nc[nH]c(=O)c23)c1 |
| InChI | InChI=1S/C21H18N4O7S/c1-11-17(18-19(27)22-10-23-21(18)32-11)20(28)24-14-9-12(7-8-15(14)26)33(29,30)25-13-5-3-4-6-16(13)31-2/h3-10,25-26H,1-2H3,(H,24,28)(H,22,23,27) |
| InChIKey | UBHBIWRDYODNHV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 163.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|