C20H20N4O5S — CID 18292276
N-[2-methoxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-5-methylpyrazine-2-carboxamide (PubChem CID 18292276) has the molecular formula C20H20N4O5S and a molecular weight of 428.47 g/mol. Its IUPAC name is N-[2-methoxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-5-methylpyrazine-2-carboxamide.
| Compound Name | N-[2-methoxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-5-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 18292276 |
| Molecular Formula | C20H20N4O5S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | N-[2-methoxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-5-methylpyrazine-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccccc2OC)cc1NC(=O)c1cnc(C)cn1 |
| InChI | InChI=1S/C20H20N4O5S/c1-13-11-22-17(12-21-13)20(25)23-16-10-14(8-9-19(16)29-3)30(26,27)24-15-6-4-5-7-18(15)28-2/h4-12,24H,1-3H3,(H,23,25) |
| InChIKey | POQILKBSYRABSW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |