C21H19ClN2O5S — CID 24514729
N-[5-[[2-(2-chlorophenoxy)phenyl]sulfamoyl]-2-methoxyphenyl]acetamide (PubChem CID 24514729) has the molecular formula C21H19ClN2O5S and a molecular weight of 446.91 g/mol. Its IUPAC name is N-[5-[[2-(2-chlorophenoxy)phenyl]sulfamoyl]-2-methoxyphenyl]acetamide.
| Compound Name | N-[5-[[2-(2-chlorophenoxy)phenyl]sulfamoyl]-2-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 24514729 |
| Molecular Formula | C21H19ClN2O5S |
| Molecular Weight | 446.91 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | N-[5-[[2-(2-chlorophenoxy)phenyl]sulfamoyl]-2-methoxyphenyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccccc2Oc2ccccc2Cl)cc1NC(C)=O |
| InChI | InChI=1S/C21H19ClN2O5S/c1-14(25)23-18-13-15(11-12-20(18)28-2)30(26,27)24-17-8-4-6-10-21(17)29-19-9-5-3-7-16(19)22/h3-13,24H,1-2H3,(H,23,25) |
| InChIKey | RQIBHSFGRMWVQV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.91 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |