C18H20N2O6S — CID 26969690
ethyl 2-[(3-acetamido-4-methoxyphenyl)sulfonylamino]benzoate (PubChem CID 26969690) has the molecular formula C18H20N2O6S and a molecular weight of 392.43 g/mol. Its IUPAC name is ethyl 2-[(3-acetamido-4-methoxyphenyl)sulfonylamino]benzoate.
| Compound Name | ethyl 2-[(3-acetamido-4-methoxyphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 26969690 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | ethyl 2-[(3-acetamido-4-methoxyphenyl)sulfonylamino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NS(=O)(=O)c1ccc(OC)c(NC(C)=O)c1 |
| InChI | InChI=1S/C18H20N2O6S/c1-4-26-18(22)14-7-5-6-8-15(14)20-27(23,24)13-9-10-17(25-3)16(11-13)19-12(2)21/h5-11,20H,4H2,1-3H3,(H,19,21) |
| InChIKey | WNYZFFPROAYPAG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |