C23H21ClN2O6S — CID 42967797
[2-(2-methoxy-5-methylanilino)-2-oxoethyl] 2-[(4-chlorophenyl)sulfonylamino]benzoate (PubChem CID 42967797) has the molecular formula C23H21ClN2O6S and a molecular weight of 488.95 g/mol. Its IUPAC name is [2-(2-methoxy-5-methylanilino)-2-oxoethyl] 2-[(4-chlorophenyl)sulfonylamino]benzoate.
| Compound Name | [2-(2-methoxy-5-methylanilino)-2-oxoethyl] 2-[(4-chlorophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 42967797 |
| Molecular Formula | C23H21ClN2O6S |
| Molecular Weight | 488.95 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | [2-(2-methoxy-5-methylanilino)-2-oxoethyl] 2-[(4-chlorophenyl)sulfonylamino]benzoate |
| SMILES | COc1ccc(C)cc1NC(=O)COC(=O)c1ccccc1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H21ClN2O6S/c1-15-7-12-21(31-2)20(13-15)25-22(27)14-32-23(28)18-5-3-4-6-19(18)26-33(29,30)17-10-8-16(24)9-11-17/h3-13,26H,14H2,1-2H3,(H,25,27) |
| InChIKey | MKDZUBWQFFNQAY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.95 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |