C16H13BrClNO4 — CID 2624069
[2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-bromobenzoate (PubChem CID 2624069) has the molecular formula C16H13BrClNO4 and a molecular weight of 398.64 g/mol. Its IUPAC name is [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-bromobenzoate.
| Compound Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-bromobenzoate |
|---|---|
| PubChem CID | 2624069 |
| Molecular Formula | C16H13BrClNO4 |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-bromobenzoate |
| SMILES | COc1ccc(Cl)cc1NC(=O)COC(=O)c1ccccc1Br |
| InChI | InChI=1S/C16H13BrClNO4/c1-22-14-7-6-10(18)8-13(14)19-15(20)9-23-16(21)11-4-2-3-5-12(11)17/h2-8H,9H2,1H3,(H,19,20) |
| InChIKey | OJDSOFLLLZSUBJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |