C16H13ClFNO4 — CID 8629592
[2-(2-methoxyanilino)-2-oxoethyl] 4-chloro-2-fluorobenzoate (PubChem CID 8629592) has the molecular formula C16H13ClFNO4 and a molecular weight of 337.73 g/mol. Its IUPAC name is [2-(2-methoxyanilino)-2-oxoethyl] 4-chloro-2-fluorobenzoate.
| Compound Name | [2-(2-methoxyanilino)-2-oxoethyl] 4-chloro-2-fluorobenzoate |
|---|---|
| PubChem CID | 8629592 |
| Molecular Formula | C16H13ClFNO4 |
| Molecular Weight | 337.73 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | [2-(2-methoxyanilino)-2-oxoethyl] 4-chloro-2-fluorobenzoate |
| SMILES | COc1ccccc1NC(=O)COC(=O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C16H13ClFNO4/c1-22-14-5-3-2-4-13(14)19-15(20)9-23-16(21)11-7-6-10(17)8-12(11)18/h2-8H,9H2,1H3,(H,19,20) |
| InChIKey | RVJUQAHCZCVNIQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.73 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |