C18H18FNO6 — CID 2566490
[2-(2-fluoroanilino)-2-oxoethyl] 2,4,5-trimethoxybenzoate (PubChem CID 2566490) has the molecular formula C18H18FNO6 and a molecular weight of 363.34 g/mol. Its IUPAC name is [2-(2-fluoroanilino)-2-oxoethyl] 2,4,5-trimethoxybenzoate.
| Compound Name | [2-(2-fluoroanilino)-2-oxoethyl] 2,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 2566490 |
| Molecular Formula | C18H18FNO6 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | [2-(2-fluoroanilino)-2-oxoethyl] 2,4,5-trimethoxybenzoate |
| SMILES | COc1cc(OC)c(C(=O)OCC(=O)Nc2ccccc2F)cc1OC |
| InChI | InChI=1S/C18H18FNO6/c1-23-14-9-16(25-3)15(24-2)8-11(14)18(22)26-10-17(21)20-13-7-5-4-6-12(13)19/h4-9H,10H2,1-3H3,(H,20,21) |
| InChIKey | FEGUQTPKESEUHU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |