C16H14ClFN2O4 — CID 2570793
[2-(2-fluoroanilino)-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate (PubChem CID 2570793) has the molecular formula C16H14ClFN2O4 and a molecular weight of 352.75 g/mol. Its IUPAC name is [2-(2-fluoroanilino)-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate.
| Compound Name | [2-(2-fluoroanilino)-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 2570793 |
| Molecular Formula | C16H14ClFN2O4 |
| Molecular Weight | 352.75 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | [2-(2-fluoroanilino)-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)OCC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C16H14ClFN2O4/c1-23-14-7-12(19)10(17)6-9(14)16(22)24-8-15(21)20-13-5-3-2-4-11(13)18/h2-7H,8,19H2,1H3,(H,20,21) |
| InChIKey | VPLFSEWWVSIRGG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.75 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|