C18H19ClN2O4 — CID 2570627
[2-(2,3-dimethylanilino)-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate (PubChem CID 2570627) has the molecular formula C18H19ClN2O4 and a molecular weight of 362.81 g/mol. Its IUPAC name is [2-(2,3-dimethylanilino)-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate.
| Compound Name | [2-(2,3-dimethylanilino)-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 2570627 |
| Molecular Formula | C18H19ClN2O4 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | [2-(2,3-dimethylanilino)-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)OCC(=O)Nc1cccc(C)c1C |
| InChI | InChI=1S/C18H19ClN2O4/c1-10-5-4-6-15(11(10)2)21-17(22)9-25-18(23)12-7-13(19)14(20)8-16(12)24-3/h4-8H,9,20H2,1-3H3,(H,21,22) |
| InChIKey | QOXPZUWFARKDNQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|