C20H22ClNO4 — CID 3394111
[2-(5-tert-butyl-2-methoxyanilino)-2-oxoethyl] 2-chlorobenzoate (PubChem CID 3394111) has the molecular formula C20H22ClNO4 and a molecular weight of 375.85 g/mol. Its IUPAC name is [2-(5-tert-butyl-2-methoxyanilino)-2-oxoethyl] 2-chlorobenzoate.
| Compound Name | [2-(5-tert-butyl-2-methoxyanilino)-2-oxoethyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 3394111 |
| Molecular Formula | C20H22ClNO4 |
| Molecular Weight | 375.85 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | [2-(5-tert-butyl-2-methoxyanilino)-2-oxoethyl] 2-chlorobenzoate |
| SMILES | COc1ccc(C(C)(C)C)cc1NC(=O)COC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C20H22ClNO4/c1-20(2,3)13-9-10-17(25-4)16(11-13)22-18(23)12-26-19(24)14-7-5-6-8-15(14)21/h5-11H,12H2,1-4H3,(H,22,23) |
| InChIKey | UUMIZGNZFZNXME-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.85 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |