C21H26N2O6S — CID 2121145
[2-(5-tert-butyl-2-methoxyanilino)-2-oxoethyl] 3-(methylsulfamoyl)benzoate (PubChem CID 2121145) has the molecular formula C21H26N2O6S and a molecular weight of 434.51 g/mol. Its IUPAC name is [2-(5-tert-butyl-2-methoxyanilino)-2-oxoethyl] 3-(methylsulfamoyl)benzoate.
| Compound Name | [2-(5-tert-butyl-2-methoxyanilino)-2-oxoethyl] 3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2121145 |
| Molecular Formula | C21H26N2O6S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | [2-(5-tert-butyl-2-methoxyanilino)-2-oxoethyl] 3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)OCC(=O)Nc2cc(C(C)(C)C)ccc2OC)c1 |
| InChI | InChI=1S/C21H26N2O6S/c1-21(2,3)15-9-10-18(28-5)17(12-15)23-19(24)13-29-20(25)14-7-6-8-16(11-14)30(26,27)22-4/h6-12,22H,13H2,1-5H3,(H,23,24) |
| InChIKey | QAFHXRQCKMPDLG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |