C18H18N2O6S — CID 2605794
[2-(2-acetylanilino)-2-oxoethyl] 3-(methylsulfamoyl)benzoate (PubChem CID 2605794) has the molecular formula C18H18N2O6S and a molecular weight of 390.42 g/mol. Its IUPAC name is [2-(2-acetylanilino)-2-oxoethyl] 3-(methylsulfamoyl)benzoate.
| Compound Name | [2-(2-acetylanilino)-2-oxoethyl] 3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2605794 |
| Molecular Formula | C18H18N2O6S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | [2-(2-acetylanilino)-2-oxoethyl] 3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)OCC(=O)Nc2ccccc2C(C)=O)c1 |
| InChI | InChI=1S/C18H18N2O6S/c1-12(21)15-8-3-4-9-16(15)20-17(22)11-26-18(23)13-6-5-7-14(10-13)27(24,25)19-2/h3-10,19H,11H2,1-2H3,(H,20,22) |
| InChIKey | CLKMBOFSEBGESS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |