C21H24ClNO5 — CID 41161591
[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl] 4-tert-butylbenzoate (PubChem CID 41161591) has the molecular formula C21H24ClNO5 and a molecular weight of 405.88 g/mol. Its IUPAC name is [2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl] 4-tert-butylbenzoate.
| Compound Name | [2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 41161591 |
| Molecular Formula | C21H24ClNO5 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | [2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl] 4-tert-butylbenzoate |
| SMILES | COc1cc(OC)c(NC(=O)COC(=O)c2ccc(C(C)(C)C)cc2)cc1Cl |
| InChI | InChI=1S/C21H24ClNO5/c1-21(2,3)14-8-6-13(7-9-14)20(25)28-12-19(24)23-16-10-15(22)17(26-4)11-18(16)27-5/h6-11H,12H2,1-5H3,(H,23,24) |
| InChIKey | UMRTXOWTLADRFF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |