C11H14ClNO4 — CID 836298
N-(5-chloro-2,4-dimethoxyphenyl)-2-methoxyacetamide (PubChem CID 836298) has the molecular formula C11H14ClNO4 and a molecular weight of 259.69 g/mol. Its IUPAC name is N-(5-chloro-2,4-dimethoxyphenyl)-2-methoxyacetamide.
| Compound Name | N-(5-chloro-2,4-dimethoxyphenyl)-2-methoxyacetamide |
|---|---|
| PubChem CID | 836298 |
| Molecular Formula | C11H14ClNO4 |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | N-(5-chloro-2,4-dimethoxyphenyl)-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C11H14ClNO4/c1-15-6-11(14)13-8-4-7(12)9(16-2)5-10(8)17-3/h4-5H,6H2,1-3H3,(H,13,14) |
| InChIKey | QMNYUZMEHXDETF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |