C16H15ClN2O6 — CID 7751407
N-(5-chloro-2,4-dimethoxyphenyl)-2-(2-nitrophenoxy)acetamide (PubChem CID 7751407) has the molecular formula C16H15ClN2O6 and a molecular weight of 366.76 g/mol. Its IUPAC name is N-(5-chloro-2,4-dimethoxyphenyl)-2-(2-nitrophenoxy)acetamide.
| Compound Name | N-(5-chloro-2,4-dimethoxyphenyl)-2-(2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 7751407 |
| Molecular Formula | C16H15ClN2O6 |
| Molecular Weight | 366.76 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | N-(5-chloro-2,4-dimethoxyphenyl)-2-(2-nitrophenoxy)acetamide |
| SMILES | COc1cc(OC)c(NC(=O)COc2ccccc2[N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C16H15ClN2O6/c1-23-14-8-15(24-2)11(7-10(14)17)18-16(20)9-25-13-6-4-3-5-12(13)19(21)22/h3-8H,9H2,1-2H3,(H,18,20) |
| InChIKey | DRESQVLNNOQHQV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.76 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|