C12H17ClN2O3 — CID 60836807
3-amino-N-(5-chloro-2,4-dimethoxyphenyl)butanamide (PubChem CID 60836807) has the molecular formula C12H17ClN2O3 and a molecular weight of 272.73 g/mol. Its IUPAC name is 3-amino-N-(5-chloro-2,4-dimethoxyphenyl)butanamide.
| Compound Name | 3-amino-N-(5-chloro-2,4-dimethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 60836807 |
| Molecular Formula | C12H17ClN2O3 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 3-amino-N-(5-chloro-2,4-dimethoxyphenyl)butanamide |
| SMILES | COc1cc(OC)c(NC(=O)CC(C)N)cc1Cl |
| InChI | InChI=1S/C12H17ClN2O3/c1-7(14)4-12(16)15-9-5-8(13)10(17-2)6-11(9)18-3/h5-7H,4,14H2,1-3H3,(H,15,16) |
| InChIKey | OCFAUKBIKFRAHD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |