C15H21ClN2O4 — CID 113001550
N-[2-(4-chloro-2,5-dimethoxyanilino)-2-oxoethyl]-3-methylbutanamide (PubChem CID 113001550) has the molecular formula C15H21ClN2O4 and a molecular weight of 328.80 g/mol. Its IUPAC name is N-[2-(4-chloro-2,5-dimethoxyanilino)-2-oxoethyl]-3-methylbutanamide.
| Compound Name | N-[2-(4-chloro-2,5-dimethoxyanilino)-2-oxoethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 113001550 |
| Molecular Formula | C15H21ClN2O4 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N-[2-(4-chloro-2,5-dimethoxyanilino)-2-oxoethyl]-3-methylbutanamide |
| SMILES | COc1cc(NC(=O)CNC(=O)CC(C)C)c(OC)cc1Cl |
| InChI | InChI=1S/C15H21ClN2O4/c1-9(2)5-14(19)17-8-15(20)18-11-7-12(21-3)10(16)6-13(11)22-4/h6-7,9H,5,8H2,1-4H3,(H,17,19)(H,18,20) |
| InChIKey | TZHZDKLUBXHMMI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |