C17H24ClN3O4 — CID 113001569
N-(4-chloro-2,5-dimethoxyphenyl)-2-(cyclohexylcarbamoylamino)acetamide (PubChem CID 113001569) has the molecular formula C17H24ClN3O4 and a molecular weight of 369.85 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-2-(cyclohexylcarbamoylamino)acetamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-(cyclohexylcarbamoylamino)acetamide |
|---|---|
| PubChem CID | 113001569 |
| Molecular Formula | C17H24ClN3O4 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-(cyclohexylcarbamoylamino)acetamide |
| SMILES | COc1cc(NC(=O)CNC(=O)NC2CCCCC2)c(OC)cc1Cl |
| InChI | InChI=1S/C17H24ClN3O4/c1-24-14-9-13(15(25-2)8-12(14)18)21-16(22)10-19-17(23)20-11-6-4-3-5-7-11/h8-9,11H,3-7,10H2,1-2H3,(H,21,22)(H2,19,20,23) |
| InChIKey | BWQVBBWKKYNWAN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |