C17H25N3O4 — CID 112999302
2-(cyclohexylcarbamoylamino)-N-(3,4-dimethoxyphenyl)acetamide (PubChem CID 112999302) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-(cyclohexylcarbamoylamino)-N-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-(cyclohexylcarbamoylamino)-N-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 112999302 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 2-(cyclohexylcarbamoylamino)-N-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CNC(=O)NC2CCCCC2)cc1OC |
| InChI | InChI=1S/C17H25N3O4/c1-23-14-9-8-13(10-15(14)24-2)19-16(21)11-18-17(22)20-12-6-4-3-5-7-12/h8-10,12H,3-7,11H2,1-2H3,(H,19,21)(H2,18,20,22) |
| InChIKey | KTGMEAGDRAATKA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |