C17H23F3N2O3 — CID 112825817
1-cycloheptyl-3-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]urea (PubChem CID 112825817) has the molecular formula C17H23F3N2O3 and a molecular weight of 360.38 g/mol. Its IUPAC name is 1-cycloheptyl-3-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]urea.
| Compound Name | 1-cycloheptyl-3-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]urea |
|---|---|
| PubChem CID | 112825817 |
| Molecular Formula | C17H23F3N2O3 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 1-cycloheptyl-3-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]urea |
| SMILES | COc1ccc(NC(=O)NC2CCCCCC2)cc1OCC(F)(F)F |
| InChI | InChI=1S/C17H23F3N2O3/c1-24-14-9-8-13(10-15(14)25-11-17(18,19)20)22-16(23)21-12-6-4-2-3-5-7-12/h8-10,12H,2-7,11H2,1H3,(H2,21,22,23) |
| InChIKey | HPIXRKHZFTYAIL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |